C15H26O3 — CID 134975171
(1aS,2R,2aS,4R,6aR,7S)-2,6a-dimethyl-4-propan-2-yl-1a,2a,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene-2,7-diol (PubChem CID 134975171) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1aS,2R,2aS,4R,6aR,7S)-2,6a-dimethyl-4-propan-2-yl-1a,2a,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene-2,7-diol.
| Compound Name | (1aS,2R,2aS,4R,6aR,7S)-2,6a-dimethyl-4-propan-2-yl-1a,2a,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene-2,7-diol |
|---|---|
| PubChem CID | 134975171 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1aS,2R,2aS,4R,6aR,7S)-2,6a-dimethyl-4-propan-2-yl-1a,2a,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene-2,7-diol |
| SMILES | CC(C)[C@@H]1CC[C@@]2(C)[C@H](O)C3O[C@@H]3[C@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C15H26O3/c1-8(2)9-5-6-14(3)10(7-9)15(4,17)13-11(18-13)12(14)16/h8-13,16-17H,5-7H2,1-4H3/t9-,10+,11?,12-,13+,14-,15-/m1/s1 |
| InChIKey | NBECASGJNYLMBC-IXKDBZIPSA-N |
| XLogP | 1.96 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|