About (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide
(2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide (PubChem CID 134975210) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide |
| PubChem CID | 134975210 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)/C=C1\CCC(C)(C)O1 |
| InChI | InChI=1S/C12H21NO2/c1-5-13(6-2)11(14)9-10-7-8-12(3,4)15-10/h9H,5-8H2,1-4H3/b10-9+ |
| InChIKey | IGFRLRPNYFYGOT-MDZDMXLPSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide?
The IUPAC name of (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide (CID 134975210) is (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide.
What is the SMILES notation for (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide?
The canonical SMILES for (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide is CCN(CC)C(=O)/C=C1\CCC(C)(C)O1.
What is the InChIKey of (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide?
The InChIKey is IGFRLRPNYFYGOT-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H21NO2/c1-5-13(6-2)11(14)9-10-7-8-12(3,4)15-10/h9H,5-8H2,1-4H3/b10-9+.
What are the key properties of (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide?
(2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide has a molecular weight of 211.30 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(5,5-dimethyloxolan-2-ylidene)-N,N-diethylacetamide is sourced from PubChem (CID 134975210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).