About (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene
(1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene (PubChem CID 134975245) has the molecular formula C28H20N6
and a molecular weight of 440.51 g/mol. Its IUPAC name is (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene.
Molecular Properties
| Compound Name | (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene |
| PubChem CID | 134975245 |
| Molecular Formula | C28H20N6 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene |
| SMILES | [N-]=[N+]=NC1(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)C1(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C28H20N6/c29-33-31-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(27,32-34-30)24-19-11-4-12-20-24/h1-20H |
| InChIKey | RTQDLTNANXWIQY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene?
The IUPAC name of (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene (CID 134975245) is (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene.
What is the SMILES notation for (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene?
The canonical SMILES for (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene is [N-]=[N+]=NC1(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)C1(N=[N+]=[N-])c1ccccc1.
What is the InChIKey of (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene?
The InChIKey is RTQDLTNANXWIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20N6/c29-33-31-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(27,32-34-30)24-19-11-4-12-20-24/h1-20H.
What are the key properties of (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene?
(1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene has a molecular weight of 440.51 g/mol, XLogP of 8.02, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-diazido-2,3,4-triphenylcyclobut-2-en-1-yl)benzene is sourced from PubChem (CID 134975245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).