About 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]
3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] (PubChem CID 134975253) has the molecular formula C8H10S
and a molecular weight of 140.25 g/mol. Its IUPAC name is 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane].
Molecular Properties
| Compound Name | 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] |
| PubChem CID | 134975253 |
| Molecular Formula | C8H10S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] |
| SMILES | [2H]C1([2H])SC12CC1C=CC2C1 |
| InChI | InChI=1S/C8H10S/c1-2-7-3-6(1)4-8(7)5-9-8/h1-2,6-7H,3-5H2/i5D2 |
| InChIKey | HAZUIGFIYAUDLJ-BFWBPSQCSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The IUPAC name of 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] (CID 134975253) is 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane].
What is the SMILES notation for 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The canonical SMILES for 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] is [2H]C1([2H])SC12CC1C=CC2C1.
What is the InChIKey of 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The InChIKey is HAZUIGFIYAUDLJ-BFWBPSQCSA-N. The full InChI is InChI=1S/C8H10S/c1-2-7-3-6(1)4-8(7)5-9-8/h1-2,6-7H,3-5H2/i5D2.
What are the key properties of 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] has a molecular weight of 140.25 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3',3'-dideuteriospiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] is sourced from PubChem (CID 134975253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).