C16H18F17N — CID 134975254
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-methyl-N-propan-2-yldodecan-2-amine (PubChem CID 134975254) has the molecular formula C16H18F17N and a molecular weight of 547.29 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-methyl-N-propan-2-yldodecan-2-amine.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-methyl-N-propan-2-yldodecan-2-amine |
|---|---|
| PubChem CID | 134975254 |
| Molecular Formula | C16H18F17N |
| Molecular Weight | 547.29 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-methyl-N-propan-2-yldodecan-2-amine |
| SMILES | CC(C)N(C)C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F17N/c1-7(2)34(4)8(3)5-6-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h7-8H,5-6H2,1-4H3 |
| InChIKey | DUIODXXNAPHVNA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.29 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|