C6H5N3 — CID 134975532
3-deuterioimidazo[1,2-b]pyridazine (PubChem CID 134975532) has the molecular formula C6H5N3 and a molecular weight of 120.13 g/mol. Its IUPAC name is 3-deuterioimidazo[1,2-b]pyridazine.
| Compound Name | 3-deuterioimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 134975532 |
| Molecular Formula | C6H5N3 |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | 3-deuterioimidazo[1,2-b]pyridazine |
| SMILES | [2H]c1cnc2cccnn12 |
| InChI | InChI=1S/C6H5N3/c1-2-6-7-4-5-9(6)8-3-1/h1-5H/i5D |
| InChIKey | VTVRXITWWZGKHV-UICOGKGYSA-N |
| XLogP | 0.73 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |