About N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine
N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine (PubChem CID 134975754) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine.
Molecular Properties
| Compound Name | N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine |
| PubChem CID | 134975754 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine |
| SMILES | CN(C)CN(C)C1=CCCCC1 |
| InChI | InChI=1S/C10H20N2/c1-11(2)9-12(3)10-7-5-4-6-8-10/h7H,4-6,8-9H2,1-3H3 |
| InChIKey | RKFHDDIIOVUNMI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine?
The IUPAC name of N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine (CID 134975754) is N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine.
What is the SMILES notation for N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine?
The canonical SMILES for N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine is CN(C)CN(C)C1=CCCCC1.
What is the InChIKey of N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine?
The InChIKey is RKFHDDIIOVUNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-11(2)9-12(3)10-7-5-4-6-8-10/h7H,4-6,8-9H2,1-3H3.
What are the key properties of N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine?
N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine has a molecular weight of 168.28 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclohexen-1-yl)-N,N,N'-trimethylmethanediamine is sourced from PubChem (CID 134975754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).