C12H22O2Si — CID 134975764
(6-methoxycyclohexa-1,4-dien-1-yl)oxy-dimethyl-propan-2-ylsilane (PubChem CID 134975764) has the molecular formula C12H22O2Si and a molecular weight of 226.39 g/mol. Its IUPAC name is (6-methoxycyclohexa-1,4-dien-1-yl)oxy-dimethyl-propan-2-ylsilane.
| Compound Name | (6-methoxycyclohexa-1,4-dien-1-yl)oxy-dimethyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 134975764 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (6-methoxycyclohexa-1,4-dien-1-yl)oxy-dimethyl-propan-2-ylsilane |
| SMILES | COC1C=CCC=C1O[Si](C)(C)C(C)C |
| InChI | InChI=1S/C12H22O2Si/c1-10(2)15(4,5)14-12-9-7-6-8-11(12)13-3/h6,8-11H,7H2,1-5H3 |
| InChIKey | VYZDUXRQDAKIEG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|