C12H18N2O — CID 134975766
(1S,2S,3E)-3-(dimethylhydrazinylidene)-2-methyl-1-phenylpropan-1-ol (PubChem CID 134975766) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1S,2S,3E)-3-(dimethylhydrazinylidene)-2-methyl-1-phenylpropan-1-ol.
| Compound Name | (1S,2S,3E)-3-(dimethylhydrazinylidene)-2-methyl-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 134975766 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1S,2S,3E)-3-(dimethylhydrazinylidene)-2-methyl-1-phenylpropan-1-ol |
| SMILES | C[C@@H](/C=N/N(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O/c1-10(9-13-14(2)3)12(15)11-7-5-4-6-8-11/h4-10,12,15H,1-3H3/b13-9+/t10-,12-/m0/s1 |
| InChIKey | MQDCQDCUSDDRRC-DMENEYKDSA-N |
| XLogP | 1.90 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|