C14H25NO2 — CID 134975772
(2R,3S)-2,3,6-trimethyl-1-pyrrolidin-1-ylheptane-1,5-dione (PubChem CID 134975772) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (2R,3S)-2,3,6-trimethyl-1-pyrrolidin-1-ylheptane-1,5-dione.
| Compound Name | (2R,3S)-2,3,6-trimethyl-1-pyrrolidin-1-ylheptane-1,5-dione |
|---|---|
| PubChem CID | 134975772 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2R,3S)-2,3,6-trimethyl-1-pyrrolidin-1-ylheptane-1,5-dione |
| SMILES | CC(C)C(=O)C[C@H](C)[C@@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H25NO2/c1-10(2)13(16)9-11(3)12(4)14(17)15-7-5-6-8-15/h10-12H,5-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | OQLHGLVSLDQPMA-NWDGAFQWSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |