About dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate
dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate (PubChem CID 134975920) has the molecular formula C8H14Li2O
and a molecular weight of 140.08 g/mol. Its IUPAC name is dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate.
Molecular Properties
| Compound Name | dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate |
| PubChem CID | 134975920 |
| Molecular Formula | C8H14Li2O |
| Molecular Weight | 140.08 g/mol |
| Exact Mass | 140.14 |
| IUPAC Name | dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate |
| SMILES | CC(C)(C)C([O-])[C@@H]1[CH-]C1.[Li+].[Li+] |
| InChI | InChI=1S/C8H14O.2Li/c1-8(2,3)7(9)6-4-5-6;;/h4,6-7H,5H2,1-3H3;;/q-2;2*+1/t6-,7?;;/m1../s1 |
| InChIKey | APUQORDITFEDBC-DKPBNVODSA-N |
| XLogP | -5.01 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.08 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate?
The IUPAC name of dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate (CID 134975920) is dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate.
What is the SMILES notation for dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate?
The canonical SMILES for dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate is CC(C)(C)C([O-])[C@@H]1[CH-]C1.[Li+].[Li+].
What is the InChIKey of dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate?
The InChIKey is APUQORDITFEDBC-DKPBNVODSA-N. The full InChI is InChI=1S/C8H14O.2Li/c1-8(2,3)7(9)6-4-5-6;;/h4,6-7H,5H2,1-3H3;;/q-2;2*+1/t6-,7?;;/m1../s1.
What are the key properties of dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate?
dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate has a molecular weight of 140.08 g/mol, XLogP of -5.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;1-cyclopropyl-2,2-dimethylpropan-1-olate is sourced from PubChem (CID 134975920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).