C9H14O — CID 134976116
(1R,2S,3R,4S,5R,7R)-4-methyltricyclo[3.3.0.03,7]octan-2-ol (PubChem CID 134976116) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R,7R)-4-methyltricyclo[3.3.0.03,7]octan-2-ol.
| Compound Name | (1R,2S,3R,4S,5R,7R)-4-methyltricyclo[3.3.0.03,7]octan-2-ol |
|---|---|
| PubChem CID | 134976116 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1R,2S,3R,4S,5R,7R)-4-methyltricyclo[3.3.0.03,7]octan-2-ol |
| SMILES | C[C@H]1[C@H]2C[C@@H]3C[C@H]2[C@H](O)[C@H]31 |
| InChI | InChI=1S/C9H14O/c1-4-6-2-5-3-7(6)9(10)8(4)5/h4-10H,2-3H2,1H3/t4-,5+,6+,7+,8-,9-/m0/s1 |
| InChIKey | FTNIIDINIXZBHM-YQWDKWCMSA-N |
| XLogP | 1.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |