About 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol
8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (PubChem CID 134976140) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
Molecular Properties
| Compound Name | 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| PubChem CID | 134976140 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| SMILES | CC#CCCC1(O)C=CC2(C=C1)OCCO2 |
| InChI | InChI=1S/C13H16O3/c1-2-3-4-5-12(14)6-8-13(9-7-12)15-10-11-16-13/h6-9,14H,4-5,10-11H2,1H3 |
| InChIKey | ZGHRAUVIUIFIKZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The IUPAC name of 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (CID 134976140) is 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
What is the SMILES notation for 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The canonical SMILES for 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol is CC#CCCC1(O)C=CC2(C=C1)OCCO2.
What is the InChIKey of 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The InChIKey is ZGHRAUVIUIFIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-2-3-4-5-12(14)6-8-13(9-7-12)15-10-11-16-13/h6-9,14H,4-5,10-11H2,1H3.
What are the key properties of 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol has a molecular weight of 220.27 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pent-3-ynyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol is sourced from PubChem (CID 134976140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).