C27H25FN2O6S — CID 134976527
ethyl (2S,6R)-6-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 134976527) has the molecular formula C27H25FN2O6S and a molecular weight of 524.57 g/mol. Its IUPAC name is ethyl (2S,6R)-6-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl (2S,6R)-6-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 134976527 |
| Molecular Formula | C27H25FN2O6S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | ethyl (2S,6R)-6-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](c2ccc([N+](=O)[O-])cc2)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C27H25FN2O6S/c1-3-36-27(31)23-16-17-25(19-10-12-20(13-11-19)30(32)33)29(26(23)22-6-4-5-7-24(22)28)37(34,35)21-14-8-18(2)9-15-21/h4-16,25-26H,3,17H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | AYKFJWLDFPMPPT-UIOOFZCWSA-N |
| XLogP | 5.41 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|