C25H44O4Si — CID 134976650
(1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 134976650) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is (1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 134976650 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CO[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](CC[C@@H]2[C@@H]3C(=CCC[C@@H]3O)C=C[C@@H]2C)O1 |
| InChI | InChI=1S/C25H44O4Si/c1-17-11-12-18-9-8-10-22(26)24(18)21(17)14-13-19-15-20(16-23(27-5)28-19)29-30(6,7)25(2,3)4/h9,11-12,17,19-24,26H,8,10,13-16H2,1-7H3/t17-,19+,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | CTIQCUIJSMNIKP-NIEJSUMHSA-N |
| XLogP | 5.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|