About methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate
methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate (PubChem CID 134976675) has the molecular formula C26H41INPS
and a molecular weight of 557.57 g/mol. Its IUPAC name is methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate.
Molecular Properties
| Compound Name | methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate |
| PubChem CID | 134976675 |
| Molecular Formula | C26H41INPS |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate |
| SMILES | CS/C(=N\c1ccccc1)P(I)(C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H41INPS/c1-30-26(28-22-14-6-2-7-15-22)29(27,23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2,6-7,14-15,23-25H,3-5,8-13,16-21H2,1H3/b28-26- |
| InChIKey | YCQDTMRJBOXGRV-SGEDCAFJSA-N |
| XLogP | 9.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate?
The IUPAC name of methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate (CID 134976675) is methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate.
What is the SMILES notation for methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate?
The canonical SMILES for methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate is CS/C(=N\c1ccccc1)P(I)(C1CCCCC1)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate?
The InChIKey is YCQDTMRJBOXGRV-SGEDCAFJSA-N. The full InChI is InChI=1S/C26H41INPS/c1-30-26(28-22-14-6-2-7-15-22)29(27,23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2,6-7,14-15,23-25H,3-5,8-13,16-21H2,1H3/b28-26-.
What are the key properties of methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate?
methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate has a molecular weight of 557.57 g/mol, XLogP of 9.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-phenyl-1-[tricyclohexyl(iodo)-λ5-phosphanyl]methanimidothioate is sourced from PubChem (CID 134976675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).