About CID 134976749
CID 134976749 (PubChem CID 134976749) has the molecular formula C24H20Cl8O10P-
and a molecular weight of 783.01 g/mol.
Molecular Properties
| Compound Name | CID 134976749 |
| PubChem CID | 134976749 |
| Molecular Formula | C24H20Cl8O10P- |
| Molecular Weight | 783.01 g/mol |
| Exact Mass | 778.83 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)[C@@H]1CO[P-]23(OC[C@H]1C(=O)OC(C)C)(Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O2)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3 |
| InChI | InChI=1S/C24H20Cl8O10P/c1-7(2)37-23(33)9-5-35-43(36-6-10(9)24(34)38-8(3)4,39-19-15(29)11(25)12(26)16(30)20(19)40-43)41-21-17(31)13(27)14(28)18(32)22(21)42-43/h7-10H,5-6H2,1-4H3/q-1/t9-,10-/m1/s1 |
| InChIKey | KITBRBQMPDEVAR-NXEZZACHSA-N |
| XLogP | 9.92 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 783.01 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134976749 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134976749?
The IUPAC name of CID 134976749 (CID 134976749) is not available.
What is the SMILES notation for CID 134976749?
The canonical SMILES for CID 134976749 is CC(C)OC(=O)[C@@H]1CO[P-]23(OC[C@H]1C(=O)OC(C)C)(Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O2)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3.
What is the InChIKey of CID 134976749?
The InChIKey is KITBRBQMPDEVAR-NXEZZACHSA-N. The full InChI is InChI=1S/C24H20Cl8O10P/c1-7(2)37-23(33)9-5-35-43(36-6-10(9)24(34)38-8(3)4,39-19-15(29)11(25)12(26)16(30)20(19)40-43)41-21-17(31)13(27)14(28)18(32)22(21)42-43/h7-10H,5-6H2,1-4H3/q-1/t9-,10-/m1/s1.
What are the key properties of CID 134976749?
CID 134976749 has a molecular weight of 783.01 g/mol, XLogP of 9.92, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134976749 is sourced from PubChem (CID 134976749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).