C15H30Si — CID 134976811
4-butylocta-2,3-dien-2-yl(trimethyl)silane (PubChem CID 134976811) has the molecular formula C15H30Si and a molecular weight of 238.49 g/mol. Its IUPAC name is 4-butylocta-2,3-dien-2-yl(trimethyl)silane.
| Compound Name | 4-butylocta-2,3-dien-2-yl(trimethyl)silane |
|---|---|
| PubChem CID | 134976811 |
| Molecular Formula | C15H30Si |
| Molecular Weight | 238.49 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | 4-butylocta-2,3-dien-2-yl(trimethyl)silane |
| SMILES | CCCCC(=C=C(C)[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C15H30Si/c1-7-9-11-15(12-10-8-2)13-14(3)16(4,5)6/h7-12H2,1-6H3 |
| InChIKey | HUHIBVNKHVHYRP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|