About methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate
methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate (PubChem CID 134976891) has the molecular formula C28H33ClNO4P
and a molecular weight of 514.00 g/mol. Its IUPAC name is methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate |
| PubChem CID | 134976891 |
| Molecular Formula | C28H33ClNO4P |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33ClNO4P/c1-22(2)21-26(27(31)33-3)30-28(32)34-19-20-35(29,23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,22,26H,19-21H2,1-3H3,(H,30,32) |
| InChIKey | TXFVNXCVAZICFQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate?
The IUPAC name of methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate (CID 134976891) is methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate.
What is the SMILES notation for methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate?
The canonical SMILES for methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate is COC(=O)C(CC(C)C)NC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate?
The InChIKey is TXFVNXCVAZICFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33ClNO4P/c1-22(2)21-26(27(31)33-3)30-28(32)34-19-20-35(29,23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,22,26H,19-21H2,1-3H3,(H,30,32).
What are the key properties of methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate?
methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate has a molecular weight of 514.00 g/mol, XLogP of 4.98, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-4-methylpentanoate is sourced from PubChem (CID 134976891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).