About ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate
ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate (PubChem CID 134976907) has the molecular formula C25H27ClNO4P
and a molecular weight of 471.92 g/mol. Its IUPAC name is ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate |
| PubChem CID | 134976907 |
| Molecular Formula | C25H27ClNO4P |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27ClNO4P/c1-2-30-24(28)20-27-25(29)31-18-19-32(26,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17H,2,18-20H2,1H3,(H,27,29) |
| InChIKey | HPLCPVUZUNXXQR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate?
The IUPAC name of ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate (CID 134976907) is ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate.
What is the SMILES notation for ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate?
The canonical SMILES for ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate is CCOC(=O)CNC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate?
The InChIKey is HPLCPVUZUNXXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27ClNO4P/c1-2-30-24(28)20-27-25(29)31-18-19-32(26,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17H,2,18-20H2,1H3,(H,27,29).
What are the key properties of ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate?
ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate has a molecular weight of 471.92 g/mol, XLogP of 3.96, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]acetate is sourced from PubChem (CID 134976907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).