About 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide
3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide (PubChem CID 134976913) has the molecular formula C26H33ClNO2PS
and a molecular weight of 490.05 g/mol. Its IUPAC name is 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide |
| PubChem CID | 134976913 |
| Molecular Formula | C26H33ClNO2PS |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide |
| SMILES | CCN(C(C)C)S(=O)(=O)CCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33ClNO2PS/c1-4-28(23(2)3)32(29,30)22-14-21-31(27,24-15-8-5-9-16-24,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20,23H,4,14,21-22H2,1-3H3 |
| InChIKey | JSCAVZRZYSBATE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide?
The IUPAC name of 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide (CID 134976913) is 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide.
What is the SMILES notation for 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide?
The canonical SMILES for 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide is CCN(C(C)C)S(=O)(=O)CCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide?
The InChIKey is JSCAVZRZYSBATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33ClNO2PS/c1-4-28(23(2)3)32(29,30)22-14-21-31(27,24-15-8-5-9-16-24,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20,23H,4,14,21-22H2,1-3H3.
What are the key properties of 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide?
3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide has a molecular weight of 490.05 g/mol, XLogP of 5.12, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(triphenyl)-λ5-phosphanyl]-N-ethyl-N-propan-2-ylpropane-1-sulfonamide is sourced from PubChem (CID 134976913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).