About 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate
2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate (PubChem CID 134976921) has the molecular formula C23H25BrNO2P
and a molecular weight of 458.34 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate |
| PubChem CID | 134976921 |
| Molecular Formula | C23H25BrNO2P |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25BrNO2P/c1-19(25)23(26)27-17-18-28(24,20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19H,17-18,25H2,1H3/t19-/m0/s1 |
| InChIKey | JCNPGCQQRYFXMM-IBGZPJMESA-N |
| XLogP | 3.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate?
The IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate (CID 134976921) is 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate is C[C@H](N)C(=O)OCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate?
The InChIKey is JCNPGCQQRYFXMM-IBGZPJMESA-N. The full InChI is InChI=1S/C23H25BrNO2P/c1-19(25)23(26)27-17-18-28(24,20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19H,17-18,25H2,1H3/t19-/m0/s1.
What are the key properties of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate?
2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate has a molecular weight of 458.34 g/mol, XLogP of 3.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-aminopropanoate is sourced from PubChem (CID 134976921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).