C24H30Si2 — CID 134977086
tert-butyl-[12-[tert-butyl(dimethyl)silyl]dodeca-1,3,5,7,9,11-hexaynyl]-dimethylsilane (PubChem CID 134977086) has the molecular formula C24H30Si2 and a molecular weight of 374.68 g/mol. Its IUPAC name is tert-butyl-[12-[tert-butyl(dimethyl)silyl]dodeca-1,3,5,7,9,11-hexaynyl]-dimethylsilane.
| Compound Name | tert-butyl-[12-[tert-butyl(dimethyl)silyl]dodeca-1,3,5,7,9,11-hexaynyl]-dimethylsilane |
|---|---|
| PubChem CID | 134977086 |
| Molecular Formula | C24H30Si2 |
| Molecular Weight | 374.68 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | tert-butyl-[12-[tert-butyl(dimethyl)silyl]dodeca-1,3,5,7,9,11-hexaynyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C#CC#CC#CC#CC#CC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H30Si2/c1-23(2,3)25(7,8)21-19-17-15-13-11-12-14-16-18-20-22-26(9,10)24(4,5)6/h1-10H3 |
| InChIKey | KTAJULLMIXYZTR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|