About 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate
2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate (PubChem CID 134977185) has the molecular formula C26H31BrNO2P
and a molecular weight of 500.42 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate |
| PubChem CID | 134977185 |
| Molecular Formula | C26H31BrNO2P |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)OCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31BrNO2P/c1-21(2)20-25(28)26(29)30-18-19-31(27,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,21,25H,18-20,28H2,1-2H3/t25-/m0/s1 |
| InChIKey | ZPFGPBAXKHCDFG-VWLOTQADSA-N |
| XLogP | 4.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate?
The IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate (CID 134977185) is 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate is CC(C)C[C@H](N)C(=O)OCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate?
The InChIKey is ZPFGPBAXKHCDFG-VWLOTQADSA-N. The full InChI is InChI=1S/C26H31BrNO2P/c1-21(2)20-25(28)26(29)30-18-19-31(27,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,21,25H,18-20,28H2,1-2H3/t25-/m0/s1.
What are the key properties of 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate?
2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate has a molecular weight of 500.42 g/mol, XLogP of 4.74, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-4-methylpentanoate is sourced from PubChem (CID 134977185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).