C26H37NO3 — CID 134977242
(3aR,4R,6R,6aS)-4-methoxy-2-phenyl-6-tetradec-4-ynyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole (PubChem CID 134977242) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3aR,4R,6R,6aS)-4-methoxy-2-phenyl-6-tetradec-4-ynyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole.
| Compound Name | (3aR,4R,6R,6aS)-4-methoxy-2-phenyl-6-tetradec-4-ynyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole |
|---|---|
| PubChem CID | 134977242 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (3aR,4R,6R,6aS)-4-methoxy-2-phenyl-6-tetradec-4-ynyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole |
| SMILES | CCCCCCCCCC#CCCC[C@H]1O[C@@H](OC)[C@@H]2N=C(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C26H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-17-20-22-24-23(26(28-2)29-22)27-25(30-24)21-18-15-14-16-19-21/h14-16,18-19,22-24,26H,3-10,13,17,20H2,1-2H3/t22-,23-,24-,26-/m1/s1 |
| InChIKey | LBQAMAMPYPVFTG-PMHJDTQVSA-N |
| XLogP | 5.89 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|