C24H22O4 — CID 134977244
[(1E,5E)-5-acetyloxy-1,6-bis(4-methylphenyl)hexa-1,5-dien-3-yn-2-yl] acetate (PubChem CID 134977244) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(1E,5E)-5-acetyloxy-1,6-bis(4-methylphenyl)hexa-1,5-dien-3-yn-2-yl] acetate.
| Compound Name | [(1E,5E)-5-acetyloxy-1,6-bis(4-methylphenyl)hexa-1,5-dien-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 134977244 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(1E,5E)-5-acetyloxy-1,6-bis(4-methylphenyl)hexa-1,5-dien-3-yn-2-yl] acetate |
| SMILES | CC(=O)O/C(C#C/C(=C\c1ccc(C)cc1)OC(C)=O)=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C24H22O4/c1-17-5-9-21(10-6-17)15-23(27-19(3)25)13-14-24(28-20(4)26)16-22-11-7-18(2)8-12-22/h5-12,15-16H,1-4H3/b23-15+,24-16+ |
| InChIKey | DRNBCXBZKGTGSK-DFEHQXHXSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|