C20H38Li2Si — CID 134977275
dilithium;dimethyl-bis(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 134977275) has the molecular formula C20H38Li2Si and a molecular weight of 320.49 g/mol. Its IUPAC name is dilithium;dimethyl-bis(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | dilithium;dimethyl-bis(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 134977275 |
| Molecular Formula | C20H38Li2Si |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | dilithium;dimethyl-bis(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | C[C-]1C(C)C(C)C([Si](C)(C)C2C(C)[C-](C)C(C)C2C)C1C.[Li+].[Li+] |
| InChI | InChI=1S/C20H38Si.2Li/c1-11-12(2)16(6)19(15(11)5)21(9,10)20-17(7)13(3)14(4)18(20)8;;/h11,13,15-20H,1-10H3;;/q-2;2*+1 |
| InChIKey | LEIOIXIEPVGJRY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|