About benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane
benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane (PubChem CID 134977304) has the molecular formula C25H30BrO2P
and a molecular weight of 473.39 g/mol. Its IUPAC name is benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane |
| PubChem CID | 134977304 |
| Molecular Formula | C25H30BrO2P |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane |
| SMILES | CCOC(CP(Br)(Cc1ccccc1)(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C25H30BrO2P/c1-3-27-25(28-4-2)21-29(26,23-16-10-6-11-17-23,24-18-12-7-13-19-24)20-22-14-8-5-9-15-22/h5-19,25H,3-4,20-21H2,1-2H3 |
| InChIKey | FSFIKIBZJULIBV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane?
The IUPAC name of benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane (CID 134977304) is benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane.
What is the SMILES notation for benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane?
The canonical SMILES for benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane is CCOC(CP(Br)(Cc1ccccc1)(c1ccccc1)c1ccccc1)OCC.
What is the InChIKey of benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane?
The InChIKey is FSFIKIBZJULIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30BrO2P/c1-3-27-25(28-4-2)21-29(26,23-16-10-6-11-17-23,24-18-12-7-13-19-24)20-22-14-8-5-9-15-22/h5-19,25H,3-4,20-21H2,1-2H3.
What are the key properties of benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane?
benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane has a molecular weight of 473.39 g/mol, XLogP of 6.10, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-bromo-(2,2-diethoxyethyl)-diphenyl-λ5-phosphane is sourced from PubChem (CID 134977304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).