C39H70O4Si3 — CID 134977333
(1S,7S,12S)-6,7,12-tris[tri(propan-2-yl)silyloxy]cyclododeca-2,3,4-trien-8,10-diyn-1-ol (PubChem CID 134977333) has the molecular formula C39H70O4Si3 and a molecular weight of 687.24 g/mol. Its IUPAC name is (1S,7S,12S)-6,7,12-tris[tri(propan-2-yl)silyloxy]cyclododeca-2,3,4-trien-8,10-diyn-1-ol.
| Compound Name | (1S,7S,12S)-6,7,12-tris[tri(propan-2-yl)silyloxy]cyclododeca-2,3,4-trien-8,10-diyn-1-ol |
|---|---|
| PubChem CID | 134977333 |
| Molecular Formula | C39H70O4Si3 |
| Molecular Weight | 687.24 g/mol |
| Exact Mass | 686.46 |
| IUPAC Name | (1S,7S,12S)-6,7,12-tris[tri(propan-2-yl)silyloxy]cyclododeca-2,3,4-trien-8,10-diyn-1-ol |
| SMILES | CC(C)[Si](OC1C=C=C=C[C@H](O)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C#CC#C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H70O4Si3/c1-27(2)44(28(3)4,29(5)6)41-37-24-21-22-26-39(43-46(33(13)14,34(15)16)35(17)18)38(25-20-19-23-36(37)40)42-45(30(7)8,31(9)10)32(11)12/h23,25,27-40H,1-18H3/b25-23-/t36-,37-,38?,39-/m0/s1 |
| InChIKey | YFBYUMXAOUTVTF-WCCDIKDASA-N |
| XLogP | 10.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.24 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|