C33H56O3Si — CID 134977358
(2S)-2-[(3S,10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhepta-3,4-diene-2,6-diol (PubChem CID 134977358) has the molecular formula C33H56O3Si and a molecular weight of 528.89 g/mol. Its IUPAC name is (2S)-2-[(3S,10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhepta-3,4-diene-2,6-diol.
| Compound Name | (2S)-2-[(3S,10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhepta-3,4-diene-2,6-diol |
|---|---|
| PubChem CID | 134977358 |
| Molecular Formula | C33H56O3Si |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (2S)-2-[(3S,10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhepta-3,4-diene-2,6-diol |
| SMILES | CC(C)(O)C=C=C[C@](C)(O)C1CCC2C3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H56O3Si/c1-29(2,3)37(9,10)36-24-16-20-31(6)23(22-24)12-13-25-26-14-15-28(32(26,7)21-17-27(25)31)33(8,35)19-11-18-30(4,5)34/h12,18-19,24-28,34-35H,13-17,20-22H2,1-10H3/t11?,24-,25?,26?,27?,28?,31-,32-,33-/m0/s1 |
| InChIKey | PSQXAIVIBZVGEA-GUZQKNDVSA-N |
| XLogP | 8.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|