About (6R)-2,6-dimethyltetracos-2-en-9-yne
(6R)-2,6-dimethyltetracos-2-en-9-yne (PubChem CID 134977384) has the molecular formula C26H48
and a molecular weight of 360.67 g/mol. Its IUPAC name is (6R)-2,6-dimethyltetracos-2-en-9-yne.
Molecular Properties
| Compound Name | (6R)-2,6-dimethyltetracos-2-en-9-yne |
| PubChem CID | 134977384 |
| Molecular Formula | C26H48 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.38 |
| IUPAC Name | (6R)-2,6-dimethyltetracos-2-en-9-yne |
| SMILES | CCCCCCCCCCCCCCC#CCC[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C26H48/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(4)24-21-22-25(2)3/h22,26H,5-17,20-21,23-24H2,1-4H3/t26-/m0/s1 |
| InChIKey | FYHVMJZJPYSPRG-SANMLTNESA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2,6-dimethyltetracos-2-en-9-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6-dimethyltetracos-2-en-9-yne?
The IUPAC name of (6R)-2,6-dimethyltetracos-2-en-9-yne (CID 134977384) is (6R)-2,6-dimethyltetracos-2-en-9-yne.
What is the SMILES notation for (6R)-2,6-dimethyltetracos-2-en-9-yne?
The canonical SMILES for (6R)-2,6-dimethyltetracos-2-en-9-yne is CCCCCCCCCCCCCCC#CCC[C@H](C)CCC=C(C)C.
What is the InChIKey of (6R)-2,6-dimethyltetracos-2-en-9-yne?
The InChIKey is FYHVMJZJPYSPRG-SANMLTNESA-N. The full InChI is InChI=1S/C26H48/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(4)24-21-22-25(2)3/h22,26H,5-17,20-21,23-24H2,1-4H3/t26-/m0/s1.
What are the key properties of (6R)-2,6-dimethyltetracos-2-en-9-yne?
(6R)-2,6-dimethyltetracos-2-en-9-yne has a molecular weight of 360.67 g/mol, XLogP of 9.24, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6-dimethyltetracos-2-en-9-yne is sourced from PubChem (CID 134977384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).