About 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-)
2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) (PubChem CID 134977418) has the molecular formula C20H21Cl6SbSi
and a molecular weight of 623.95 g/mol. Its IUPAC name is 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-).
Molecular Properties
| Compound Name | 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) |
| PubChem CID | 134977418 |
| Molecular Formula | C20H21Cl6SbSi |
| Molecular Weight | 623.95 g/mol |
| Exact Mass | 619.86 |
| IUPAC Name | 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) |
| SMILES | C[Si](C)(C)C#CC1[C+](c2ccccc2)C1c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H21Si.6ClH.Sb/c1-21(2,3)15-14-18-19(16-10-6-4-7-11-16)20(18)17-12-8-5-9-13-17;;;;;;;/h4-13,18-19H,1-3H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | PNNGHJSNGMGCCF-UHFFFAOYSA-H |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 623.95 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-)?
The IUPAC name of 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) (CID 134977418) is 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-).
What is the SMILES notation for 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-)?
The canonical SMILES for 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) is C[Si](C)(C)C#CC1[C+](c2ccccc2)C1c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-)?
The InChIKey is PNNGHJSNGMGCCF-UHFFFAOYSA-H. The full InChI is InChI=1S/C20H21Si.6ClH.Sb/c1-21(2,3)15-14-18-19(16-10-6-4-7-11-16)20(18)17-12-8-5-9-13-17;;;;;;;/h4-13,18-19H,1-3H3;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-)?
2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) has a molecular weight of 623.95 g/mol, XLogP of 8.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-diphenylcyclopropyl)ethynyl-trimethylsilane;hexachloroantimony(1-) is sourced from PubChem (CID 134977418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).