C10H10O — CID 134977567
11-oxatricyclo[6.2.1.02,7]undeca-2,5,9-triene (PubChem CID 134977567) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 11-oxatricyclo[6.2.1.02,7]undeca-2,5,9-triene.
| Compound Name | 11-oxatricyclo[6.2.1.02,7]undeca-2,5,9-triene |
|---|---|
| PubChem CID | 134977567 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 11-oxatricyclo[6.2.1.02,7]undeca-2,5,9-triene |
| SMILES | C1=CC2C(=CC1)C1C=CC2O1 |
| InChI | InChI=1S/C10H10O/c1-2-4-8-7(3-1)9-5-6-10(8)11-9/h1,3-7,9-10H,2H2 |
| InChIKey | QAPFWVIEBOZFFB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|