C39H70O4Si3 — CID 134977613
(6S,7S,10E)-1,6,7-tris[tri(propan-2-yl)silyloxy]-4,5,8,9-tetradehydro-1,2,6,7-tetrahydrocyclopenta[9]annulen-2-ol (PubChem CID 134977613) has the molecular formula C39H70O4Si3 and a molecular weight of 687.24 g/mol. Its IUPAC name is (6S,7S,10E)-1,6,7-tris[tri(propan-2-yl)silyloxy]-4,5,8,9-tetradehydro-1,2,6,7-tetrahydrocyclopenta[9]annulen-2-ol.
| Compound Name | (6S,7S,10E)-1,6,7-tris[tri(propan-2-yl)silyloxy]-4,5,8,9-tetradehydro-1,2,6,7-tetrahydrocyclopenta[9]annulen-2-ol |
|---|---|
| PubChem CID | 134977613 |
| Molecular Formula | C39H70O4Si3 |
| Molecular Weight | 687.24 g/mol |
| Exact Mass | 686.46 |
| IUPAC Name | (6S,7S,10E)-1,6,7-tris[tri(propan-2-yl)silyloxy]-4,5,8,9-tetradehydro-1,2,6,7-tetrahydrocyclopenta[9]annulen-2-ol |
| SMILES | CC(C)[Si](OC1/C2=C/C#C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C#CC2=CC1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H70O4Si3/c1-25(2)44(26(3)4,27(5)6)41-37-21-19-20-35-34(22-23-38(37)42-45(28(7)8,29(9)10)30(11)12)24-36(40)39(35)43-46(31(13)14,32(15)16)33(17)18/h20,24-33,36-40H,1-18H3/b35-20+/t36?,37-,38-,39?/m0/s1 |
| InChIKey | LRHJHIIXZHXSJU-ZKSWTKRSSA-N |
| XLogP | 10.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.24 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|