C15H12O — CID 134977681
16-oxatetracyclo[11.2.1.02,12.04,9]hexadeca-2,4,6,8,10,14-hexaene (PubChem CID 134977681) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is 16-oxatetracyclo[11.2.1.02,12.04,9]hexadeca-2,4,6,8,10,14-hexaene.
| Compound Name | 16-oxatetracyclo[11.2.1.02,12.04,9]hexadeca-2,4,6,8,10,14-hexaene |
|---|---|
| PubChem CID | 134977681 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 16-oxatetracyclo[11.2.1.02,12.04,9]hexadeca-2,4,6,8,10,14-hexaene |
| SMILES | C1=CC2C(=Cc3ccccc31)C1C=CC2O1 |
| InChI | InChI=1S/C15H12O/c1-2-4-11-9-13-12(6-5-10(11)3-1)14-7-8-15(13)16-14/h1-9,12,14-15H |
| InChIKey | IYZOVKSUCCIVGJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|