About N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide
N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide (PubChem CID 134977829) has the molecular formula C34H31ClNOP
and a molecular weight of 536.06 g/mol. Its IUPAC name is N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide.
Molecular Properties
| Compound Name | N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide |
| PubChem CID | 134977829 |
| Molecular Formula | C34H31ClNOP |
| Molecular Weight | 536.06 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide |
| SMILES | O=C(CP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H31ClNOP/c35-38(31-20-10-3-11-21-31,32-22-12-4-13-23-32,33-24-14-5-15-25-33)28-34(37)36(26-29-16-6-1-7-17-29)27-30-18-8-2-9-19-30/h1-25H,26-28H2 |
| InChIKey | FASYFGIBYKWQDY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.06 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide?
The IUPAC name of N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide (CID 134977829) is N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide.
What is the SMILES notation for N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide?
The canonical SMILES for N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide is O=C(CP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide?
The InChIKey is FASYFGIBYKWQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H31ClNOP/c35-38(31-20-10-3-11-21-31,32-22-12-4-13-23-32,33-24-14-5-15-25-33)28-34(37)36(26-29-16-6-1-7-17-29)27-30-18-8-2-9-19-30/h1-25H,26-28H2.
What are the key properties of N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide?
N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide has a molecular weight of 536.06 g/mol, XLogP of 6.90, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-2-[chloro(triphenyl)-λ5-phosphanyl]acetamide is sourced from PubChem (CID 134977829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).