About 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate
2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 134978011) has the molecular formula C24H27BrNO2P
and a molecular weight of 472.36 g/mol. Its IUPAC name is 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate |
| PubChem CID | 134978011 |
| Molecular Formula | C24H27BrNO2P |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | CP(Br)(CCOC(=O)[C@@H](N)Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27BrNO2P/c1-29(25,21-13-7-3-8-14-21,22-15-9-4-10-16-22)18-17-28-24(27)23(26)19-20-11-5-2-6-12-20/h2-16,23H,17-19,26H2,1H3/t23-/m0/s1 |
| InChIKey | HFMKWNSWOFZZAF-QHCPKHFHSA-N |
| XLogP | 4.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate?
The IUPAC name of 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate (CID 134978011) is 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate.
What is the SMILES notation for 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate?
The canonical SMILES for 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate is CP(Br)(CCOC(=O)[C@@H](N)Cc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate?
The InChIKey is HFMKWNSWOFZZAF-QHCPKHFHSA-N. The full InChI is InChI=1S/C24H27BrNO2P/c1-29(25,21-13-7-3-8-14-21,22-15-9-4-10-16-22)18-17-28-24(27)23(26)19-20-11-5-2-6-12-20/h2-16,23H,17-19,26H2,1H3/t23-/m0/s1.
What are the key properties of 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate?
2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate has a molecular weight of 472.36 g/mol, XLogP of 4.24, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromo-methyl-diphenyl-λ5-phosphanyl)ethyl (2S)-2-amino-3-phenylpropanoate is sourced from PubChem (CID 134978011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).