C14H22 — CID 134978043
2,3,8,9-tetramethyldeca-4,6-diyne (PubChem CID 134978043) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 2,3,8,9-tetramethyldeca-4,6-diyne.
| Compound Name | 2,3,8,9-tetramethyldeca-4,6-diyne |
|---|---|
| PubChem CID | 134978043 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2,3,8,9-tetramethyldeca-4,6-diyne |
| SMILES | CC(C)C(C)C#CC#CC(C)C(C)C |
| InChI | InChI=1S/C14H22/c1-11(2)13(5)9-7-8-10-14(6)12(3)4/h11-14H,1-6H3 |
| InChIKey | MWWDPOIFVRYCAN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|