About (Z)-N,N-dimethylbut-1-en-3-yn-1-amine
(Z)-N,N-dimethylbut-1-en-3-yn-1-amine (PubChem CID 134978119) has the molecular formula C6H9N
and a molecular weight of 95.14 g/mol. Its IUPAC name is (Z)-N,N-dimethylbut-1-en-3-yn-1-amine.
Molecular Properties
| Compound Name | (Z)-N,N-dimethylbut-1-en-3-yn-1-amine |
| PubChem CID | 134978119 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | (Z)-N,N-dimethylbut-1-en-3-yn-1-amine |
| SMILES | C#C/C=C\N(C)C |
| InChI | InChI=1S/C6H9N/c1-4-5-6-7(2)3/h1,5-6H,2-3H3/b6-5- |
| InChIKey | RPGUSJXDACYPMP-WAYWQWQTSA-N |
| XLogP | 0.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dimethylbut-1-en-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethylbut-1-en-3-yn-1-amine?
The IUPAC name of (Z)-N,N-dimethylbut-1-en-3-yn-1-amine (CID 134978119) is (Z)-N,N-dimethylbut-1-en-3-yn-1-amine.
What is the SMILES notation for (Z)-N,N-dimethylbut-1-en-3-yn-1-amine?
The canonical SMILES for (Z)-N,N-dimethylbut-1-en-3-yn-1-amine is C#C/C=C\N(C)C.
What is the InChIKey of (Z)-N,N-dimethylbut-1-en-3-yn-1-amine?
The InChIKey is RPGUSJXDACYPMP-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H9N/c1-4-5-6-7(2)3/h1,5-6H,2-3H3/b6-5-.
What are the key properties of (Z)-N,N-dimethylbut-1-en-3-yn-1-amine?
(Z)-N,N-dimethylbut-1-en-3-yn-1-amine has a molecular weight of 95.14 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethylbut-1-en-3-yn-1-amine is sourced from PubChem (CID 134978119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).