About bicyclo[13.3.1]nonadeca-4,11-diyne
bicyclo[13.3.1]nonadeca-4,11-diyne (PubChem CID 134978276) has the molecular formula C19H28
and a molecular weight of 256.43 g/mol. Its IUPAC name is bicyclo[13.3.1]nonadeca-4,11-diyne.
Molecular Properties
| Compound Name | bicyclo[13.3.1]nonadeca-4,11-diyne |
| PubChem CID | 134978276 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | bicyclo[13.3.1]nonadeca-4,11-diyne |
| SMILES | C1#CCCC2CCCC(CCC#CCCCCC1)C2 |
| InChI | InChI=1S/C19H28/c1-2-4-6-8-10-13-18-15-12-16-19(17-18)14-11-9-7-5-3-1/h18-19H,1-5,10-17H2 |
| InChIKey | MTVZRZKQOFXYCV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[13.3.1]nonadeca-4,11-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[13.3.1]nonadeca-4,11-diyne?
The IUPAC name of bicyclo[13.3.1]nonadeca-4,11-diyne (CID 134978276) is bicyclo[13.3.1]nonadeca-4,11-diyne.
What is the SMILES notation for bicyclo[13.3.1]nonadeca-4,11-diyne?
The canonical SMILES for bicyclo[13.3.1]nonadeca-4,11-diyne is C1#CCCC2CCCC(CCC#CCCCCC1)C2.
What is the InChIKey of bicyclo[13.3.1]nonadeca-4,11-diyne?
The InChIKey is MTVZRZKQOFXYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28/c1-2-4-6-8-10-13-18-15-12-16-19(17-18)14-11-9-7-5-3-1/h18-19H,1-5,10-17H2.
What are the key properties of bicyclo[13.3.1]nonadeca-4,11-diyne?
bicyclo[13.3.1]nonadeca-4,11-diyne has a molecular weight of 256.43 g/mol, XLogP of 5.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[13.3.1]nonadeca-4,11-diyne is sourced from PubChem (CID 134978276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).