C16H20O3S — CID 134978421
8-[1-(benzenesulfinyl)ethylidene]-1,4-dioxaspiro[4.5]decane (PubChem CID 134978421) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 8-[1-(benzenesulfinyl)ethylidene]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[1-(benzenesulfinyl)ethylidene]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134978421 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 8-[1-(benzenesulfinyl)ethylidene]-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(=C1CCC2(CC1)OCCO2)S(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O3S/c1-13(20(17)15-5-3-2-4-6-15)14-7-9-16(10-8-14)18-11-12-19-16/h2-6H,7-12H2,1H3 |
| InChIKey | NZIMVSSHXZIDKC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |