C24H40OSi — CID 134978481
(6R,7R)-3,3-dimethyl-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol (PubChem CID 134978481) has the molecular formula C24H40OSi and a molecular weight of 372.67 g/mol. Its IUPAC name is (6R,7R)-3,3-dimethyl-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol.
| Compound Name | (6R,7R)-3,3-dimethyl-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol |
|---|---|
| PubChem CID | 134978481 |
| Molecular Formula | C24H40OSi |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (6R,7R)-3,3-dimethyl-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol |
| SMILES | C=CCCCCC=C=C[C@@H](O)[C@](C#CC)(CCC(C)(C)C=C)[Si](C)(C)C |
| InChI | InChI=1S/C24H40OSi/c1-9-12-13-14-15-16-17-18-22(25)24(19-10-2,26(6,7)8)21-20-23(4,5)11-3/h9,11,16,18,22,25H,1,3,12-15,20-21H2,2,4-8H3/t17?,22-,24+/m1/s1 |
| InChIKey | DYXWDZBLFZVLAN-JULHGLQNSA-N |
| XLogP | 6.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|