About trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride
trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride (PubChem CID 134978577) has the molecular formula C12H24ClN
and a molecular weight of 217.78 g/mol. Its IUPAC name is trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride.
Molecular Properties
| Compound Name | trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride |
| PubChem CID | 134978577 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride |
| SMILES | CC(C)C(=C=C[N+](C)(C)C)C(C)C.[Cl-] |
| InChI | InChI=1S/C12H24N.ClH/c1-10(2)12(11(3)4)8-9-13(5,6)7;/h9-11H,1-7H3;1H/q+1;/p-1 |
| InChIKey | QXXKLADDZQSSMV-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride?
The IUPAC name of trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride (CID 134978577) is trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride.
What is the SMILES notation for trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride?
The canonical SMILES for trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride is CC(C)C(=C=C[N+](C)(C)C)C(C)C.[Cl-].
What is the InChIKey of trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride?
The InChIKey is QXXKLADDZQSSMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24N.ClH/c1-10(2)12(11(3)4)8-9-13(5,6)7;/h9-11H,1-7H3;1H/q+1;/p-1.
What are the key properties of trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride?
trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride has a molecular weight of 217.78 g/mol, XLogP of 0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(4-methyl-3-propan-2-ylpenta-1,2-dienyl)azanium chloride is sourced from PubChem (CID 134978577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).