About CID 134978707
CID 134978707 (PubChem CID 134978707) has the molecular formula C5H6BN3
and a molecular weight of 118.94 g/mol.
Molecular Properties
| Compound Name | CID 134978707 |
| PubChem CID | 134978707 |
| Molecular Formula | C5H6BN3 |
| Molecular Weight | 118.94 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | — |
| SMILES | CC1=NC=C[NH+]1[B-]C#N |
| InChI | InChI=1S/C5H6BN3/c1-5-8-2-3-9(5)6-4-7/h2-3,9H,1H3 |
| InChIKey | KSWCLNNJXOBRAY-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 40.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.94 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134978707 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134978707?
The IUPAC name of CID 134978707 (CID 134978707) is not available.
What is the SMILES notation for CID 134978707?
The canonical SMILES for CID 134978707 is CC1=NC=C[NH+]1[B-]C#N.
What is the InChIKey of CID 134978707?
The InChIKey is KSWCLNNJXOBRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BN3/c1-5-8-2-3-9(5)6-4-7/h2-3,9H,1H3.
What are the key properties of CID 134978707?
CID 134978707 has a molecular weight of 118.94 g/mol, XLogP of -1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134978707 is sourced from PubChem (CID 134978707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).