C15H31BO2Sn — CID 134978719
trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]stannane (PubChem CID 134978719) has the molecular formula C15H31BO2Sn and a molecular weight of 372.93 g/mol. Its IUPAC name is trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]stannane.
| Compound Name | trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]stannane |
|---|---|
| PubChem CID | 134978719 |
| Molecular Formula | C15H31BO2Sn |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-enyl]stannane |
| SMILES | CCCC/C=C(/B1OC(C)(C)C(C)(C)O1)[Sn](C)(C)C |
| InChI | InChI=1S/C12H22BO2.3CH3.Sn/c1-6-7-8-9-10-13-14-11(2,3)12(4,5)15-13;;;;/h9H,6-8H2,1-5H3;3*1H3; |
| InChIKey | RAVDEMUUMZSFDY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|