C12H23N — CID 134978798
(1R,6R)-6-butyl-3,4-dimethylcyclohex-3-en-1-amine (PubChem CID 134978798) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (1R,6R)-6-butyl-3,4-dimethylcyclohex-3-en-1-amine.
| Compound Name | (1R,6R)-6-butyl-3,4-dimethylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 134978798 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (1R,6R)-6-butyl-3,4-dimethylcyclohex-3-en-1-amine |
| SMILES | CCCC[C@@H]1CC(C)=C(C)C[C@H]1N |
| InChI | InChI=1S/C12H23N/c1-4-5-6-11-7-9(2)10(3)8-12(11)13/h11-12H,4-8,13H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | YMUBFNOZBLKHOW-VXGBXAGGSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|