About trimethylgermyl N,N-diethylcarbamate
trimethylgermyl N,N-diethylcarbamate (PubChem CID 134978998) has the molecular formula C8H19GeNO2
and a molecular weight of 233.85 g/mol. Its IUPAC name is trimethylgermyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | trimethylgermyl N,N-diethylcarbamate |
| PubChem CID | 134978998 |
| Molecular Formula | C8H19GeNO2 |
| Molecular Weight | 233.85 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | trimethylgermyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[Ge](C)(C)C |
| InChI | InChI=1S/C8H19GeNO2/c1-6-10(7-2)8(11)12-9(3,4)5/h6-7H2,1-5H3 |
| InChIKey | QIDPIHWVXDLRMZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trimethylgermyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylgermyl N,N-diethylcarbamate?
The IUPAC name of trimethylgermyl N,N-diethylcarbamate (CID 134978998) is trimethylgermyl N,N-diethylcarbamate.
What is the SMILES notation for trimethylgermyl N,N-diethylcarbamate?
The canonical SMILES for trimethylgermyl N,N-diethylcarbamate is CCN(CC)C(=O)O[Ge](C)(C)C.
What is the InChIKey of trimethylgermyl N,N-diethylcarbamate?
The InChIKey is QIDPIHWVXDLRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19GeNO2/c1-6-10(7-2)8(11)12-9(3,4)5/h6-7H2,1-5H3.
What are the key properties of trimethylgermyl N,N-diethylcarbamate?
trimethylgermyl N,N-diethylcarbamate has a molecular weight of 233.85 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylgermyl N,N-diethylcarbamate is sourced from PubChem (CID 134978998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).