About 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane
1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane (PubChem CID 134979201) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane.
Molecular Properties
| Compound Name | 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane |
| PubChem CID | 134979201 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane |
| SMILES | C=C(C)C(CCC(C)C)C1(C)CC1 |
| InChI | InChI=1S/C13H24/c1-10(2)6-7-12(11(3)4)13(5)8-9-13/h10,12H,3,6-9H2,1-2,4-5H3 |
| InChIKey | NAZHJSIUZWYLSJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane?
The IUPAC name of 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane (CID 134979201) is 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane.
What is the SMILES notation for 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane?
The canonical SMILES for 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane is C=C(C)C(CCC(C)C)C1(C)CC1.
What is the InChIKey of 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane?
The InChIKey is NAZHJSIUZWYLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-10(2)6-7-12(11(3)4)13(5)8-9-13/h10,12H,3,6-9H2,1-2,4-5H3.
What are the key properties of 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane?
1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane has a molecular weight of 180.33 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylhept-1-en-3-yl)-1-methylcyclopropane is sourced from PubChem (CID 134979201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).