About tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate
tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate (PubChem CID 134979291) has the molecular formula C18H33NO4
and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate |
| PubChem CID | 134979291 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate |
| SMILES | COC(=O)CC(C)(C)CCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H33NO4/c1-17(2,3)23-16(21)19-11-8-14(9-12-19)7-10-18(4,5)13-15(20)22-6/h14H,7-13H2,1-6H3 |
| InChIKey | UYWUJHYZBFDKFK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate (CID 134979291) is tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate is COC(=O)CC(C)(C)CCC1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate?
The InChIKey is UYWUJHYZBFDKFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO4/c1-17(2,3)23-16(21)19-11-8-14(9-12-19)7-10-18(4,5)13-15(20)22-6/h14H,7-13H2,1-6H3.
What are the key properties of tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate?
tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate has a molecular weight of 327.47 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5-methoxy-3,3-dimethyl-5-oxopentyl)piperidine-1-carboxylate is sourced from PubChem (CID 134979291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).