About (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile
(2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile (PubChem CID 13497933) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile |
| PubChem CID | 13497933 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile |
| SMILES | N#C[C@@H]1CCC[C@H](C#N)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H15N3/c15-9-13-7-4-8-14(10-16)17(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-8,11H2/t13-,14+ |
| InChIKey | HYOKFAVTFNEWSQ-OKILXGFUSA-N |
| XLogP | 2.46 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile?
The IUPAC name of (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile (CID 13497933) is (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile.
What is the SMILES notation for (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile?
The canonical SMILES for (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile is N#C[C@@H]1CCC[C@H](C#N)N1Cc1ccccc1.
What is the InChIKey of (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile?
The InChIKey is HYOKFAVTFNEWSQ-OKILXGFUSA-N. The full InChI is InChI=1S/C14H15N3/c15-9-13-7-4-8-14(10-16)17(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-8,11H2/t13-,14+.
What are the key properties of (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile?
(2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile has a molecular weight of 225.30 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-1-benzylpiperidine-2,6-dicarbonitrile is sourced from PubChem (CID 13497933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).